C13H19N3O3S — CID 43581148
N-(3-aminophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide (PubChem CID 43581148) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-(3-aminophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide.
| Compound Name | N-(3-aminophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide |
|---|---|
| PubChem CID | 43581148 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-(3-aminophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide |
| SMILES | CC(C(=O)Nc1cccc(N)c1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H19N3O3S/c1-10(16-5-7-20(18,19)8-6-16)13(17)15-12-4-2-3-11(14)9-12/h2-4,9-10H,5-8,14H2,1H3,(H,15,17) |
| InChIKey | KGPQSBNQOYDYAL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|