C12H15N3O2S2 — CID 43581384
5-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 43581384) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 5-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | 5-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 43581384 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 5-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | Cc1nc2cc(N3CCS(=O)(=O)CC3)c(N)cc2s1 |
| InChI | InChI=1S/C12H15N3O2S2/c1-8-14-10-7-11(9(13)6-12(10)18-8)15-2-4-19(16,17)5-3-15/h6-7H,2-5,13H2,1H3 |
| InChIKey | OIOMNHKIMKQELY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|