About 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide
4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide (PubChem CID 43581562) has the molecular formula C9H18N2O2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide |
| PubChem CID | 43581562 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(C2CCCNC2)CC1 |
| InChI | InChI=1S/C9H18N2O2S/c12-14(13)6-4-11(5-7-14)9-2-1-3-10-8-9/h9-10H,1-8H2 |
| InChIKey | FGVBQHIMNQYWHB-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide?
The IUPAC name of 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide (CID 43581562) is 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide.
What is the SMILES notation for 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide?
The canonical SMILES for 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide is O=S1(=O)CCN(C2CCCNC2)CC1.
What is the InChIKey of 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide?
The InChIKey is FGVBQHIMNQYWHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2S/c12-14(13)6-4-11(5-7-14)9-2-1-3-10-8-9/h9-10H,1-8H2.
What are the key properties of 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide?
4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide has a molecular weight of 218.32 g/mol, XLogP of -0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-3-yl-1,4-thiazinane 1,1-dioxide is sourced from PubChem (CID 43581562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).