C11H15ClN2O2S — CID 43581765
[2-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methanamine (PubChem CID 43581765) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is [2-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methanamine.
| Compound Name | [2-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 43581765 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [2-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methanamine |
| SMILES | NCc1c(Cl)cccc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H15ClN2O2S/c12-10-2-1-3-11(9(10)8-13)14-4-6-17(15,16)7-5-14/h1-3H,4-8,13H2 |
| InChIKey | CKQGKYFIVLIKMC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |