About (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone
(4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 43581847) has the molecular formula C11H12BrNO3S
and a molecular weight of 318.19 g/mol. Its IUPAC name is (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
Molecular Properties
| Compound Name | (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| PubChem CID | 43581847 |
| Molecular Formula | C11H12BrNO3S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(c1ccc(Br)cc1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H12BrNO3S/c12-10-3-1-9(2-4-10)11(14)13-5-7-17(15,16)8-6-13/h1-4H,5-8H2 |
| InChIKey | JZVOMFPVZJBLRG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The IUPAC name of (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (CID 43581847) is (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
What is the SMILES notation for (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The canonical SMILES for (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone is O=C(c1ccc(Br)cc1)N1CCS(=O)(=O)CC1.
What is the InChIKey of (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The InChIKey is JZVOMFPVZJBLRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrNO3S/c12-10-3-1-9(2-4-10)11(14)13-5-7-17(15,16)8-6-13/h1-4H,5-8H2.
What are the key properties of (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone?
(4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone has a molecular weight of 318.19 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone is sourced from PubChem (CID 43581847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).