About 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide
3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide (PubChem CID 43581927) has the molecular formula C7H13N3O4S
and a molecular weight of 235.26 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide.
Molecular Properties
| Compound Name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide |
| PubChem CID | 43581927 |
| Molecular Formula | C7H13N3O4S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide |
| SMILES | N/C(CC(=O)N1CCS(=O)(=O)CC1)=N\O |
| InChI | InChI=1S/C7H13N3O4S/c8-6(9-12)5-7(11)10-1-3-15(13,14)4-2-10/h12H,1-5H2,(H2,8,9) |
| InChIKey | CDVDOBBYBIXXJP-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide?
The IUPAC name of 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide (CID 43581927) is 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide.
What is the SMILES notation for 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide?
The canonical SMILES for 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide is N/C(CC(=O)N1CCS(=O)(=O)CC1)=N\O.
What is the InChIKey of 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide?
The InChIKey is CDVDOBBYBIXXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O4S/c8-6(9-12)5-7(11)10-1-3-15(13,14)4-2-10/h12H,1-5H2,(H2,8,9).
What are the key properties of 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide?
3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide has a molecular weight of 235.26 g/mol, XLogP of -1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-3-oxopropanimidamide is sourced from PubChem (CID 43581927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).