3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid

C10H15N3O3 — CID 43583226

IUPAC3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid
SMILESCc1n[nH]c(C)c1C(=O)NC(C)CC(=O)O
InChIInChI=1S/C10H15N3O3/c1-5(4-8(14)15)11-10(16)9-6(2)12-13-7(9)3/h5H,4H2,1-3H3,(H,11,16)(H,12,13)(H,14,15)
InChIKeyFFFOEZDXYWNMNT-UHFFFAOYSA-N
MW225.25 g/mol
LogP0.62
Rot. Bonds4

About 3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid

3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid (PubChem CID 43583226) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid.

Molecular Properties

Compound Name3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid
PubChem CID43583226
Molecular FormulaC10H15N3O3
Molecular Weight225.25 g/mol
Exact Mass225.11
IUPAC Name3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid
SMILESCc1n[nH]c(C)c1C(=O)NC(C)CC(=O)O
InChIInChI=1S/C10H15N3O3/c1-5(4-8(14)15)11-10(16)9-6(2)12-13-7(9)3/h5H,4H2,1-3H3,(H,11,16)(H,12,13)(H,14,15)
InChIKeyFFFOEZDXYWNMNT-UHFFFAOYSA-N
XLogP0.62
TPSA95.08 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 50.62
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid?
The IUPAC name of 3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid (CID 43583226) is 3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid.
What is the SMILES notation for 3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid?
The canonical SMILES for 3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid is Cc1n[nH]c(C)c1C(=O)NC(C)CC(=O)O.
What is the InChIKey of 3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid?
The InChIKey is FFFOEZDXYWNMNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-5(4-8(14)15)11-10(16)9-6(2)12-13-7(9)3/h5H,4H2,1-3H3,(H,11,16)(H,12,13)(H,14,15).
What are the key properties of 3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid?
3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid has a molecular weight of 225.25 g/mol, XLogP of 0.62, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]butanoic acid is sourced from PubChem (CID 43583226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).