C15H14FNO2 — CID 43583494
N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-4-fluoroaniline (PubChem CID 43583494) has the molecular formula C15H14FNO2 and a molecular weight of 259.28 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-4-fluoroaniline.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-4-fluoroaniline |
|---|---|
| PubChem CID | 43583494 |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-4-fluoroaniline |
| SMILES | Fc1ccc(NCc2cccc3c2OCCO3)cc1 |
| InChI | InChI=1S/C15H14FNO2/c16-12-4-6-13(7-5-12)17-10-11-2-1-3-14-15(11)19-9-8-18-14/h1-7,17H,8-10H2 |
| InChIKey | CARCUYFZIXIAGY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |