C14H19NO3 — CID 43583752
N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-3-ethenoxypropan-1-amine (PubChem CID 43583752) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-3-ethenoxypropan-1-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-3-ethenoxypropan-1-amine |
|---|---|
| PubChem CID | 43583752 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-3-ethenoxypropan-1-amine |
| SMILES | C=COCCCNCc1cccc2c1OCCO2 |
| InChI | InChI=1S/C14H19NO3/c1-2-16-8-4-7-15-11-12-5-3-6-13-14(12)18-10-9-17-13/h2-3,5-6,15H,1,4,7-11H2 |
| InChIKey | MARSEBUNIJTYDB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|