C15H23Cl2N3 — CID 43585100
2-(2,6-dichlorophenyl)-2-(4-propan-2-ylpiperazin-1-yl)ethanamine (PubChem CID 43585100) has the molecular formula C15H23Cl2N3 and a molecular weight of 316.28 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-2-(4-propan-2-ylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(2,6-dichlorophenyl)-2-(4-propan-2-ylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 43585100 |
| Molecular Formula | C15H23Cl2N3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-2-(4-propan-2-ylpiperazin-1-yl)ethanamine |
| SMILES | CC(C)N1CCN(C(CN)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C15H23Cl2N3/c1-11(2)19-6-8-20(9-7-19)14(10-18)15-12(16)4-3-5-13(15)17/h3-5,11,14H,6-10,18H2,1-2H3 |
| InChIKey | YPCRDQQRUVQUJP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |