About N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide
N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide (PubChem CID 43587286) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide |
| PubChem CID | 43587286 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide |
| SMILES | CCCN(CC1CC1)C(=O)C(=O)NCCN |
| InChI | InChI=1S/C11H21N3O2/c1-2-7-14(8-9-3-4-9)11(16)10(15)13-6-5-12/h9H,2-8,12H2,1H3,(H,13,15) |
| InChIKey | NIOXTSWMOCXRMP-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide?
The IUPAC name of N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide (CID 43587286) is N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide.
What is the SMILES notation for N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide?
The canonical SMILES for N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide is CCCN(CC1CC1)C(=O)C(=O)NCCN.
What is the InChIKey of N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide?
The InChIKey is NIOXTSWMOCXRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c1-2-7-14(8-9-3-4-9)11(16)10(15)13-6-5-12/h9H,2-8,12H2,1H3,(H,13,15).
What are the key properties of N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide?
N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide has a molecular weight of 227.31 g/mol, XLogP of -0.29, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N'-(cyclopropylmethyl)-N'-propyloxamide is sourced from PubChem (CID 43587286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).