C16H18N4O — CID 43588221
8-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]quinolin-5-amine (PubChem CID 43588221) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 8-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]quinolin-5-amine.
| Compound Name | 8-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]quinolin-5-amine |
|---|---|
| PubChem CID | 43588221 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 8-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]quinolin-5-amine |
| SMILES | Cc1cc(CN(C)Cc2ccc(N)c3cccnc23)no1 |
| InChI | InChI=1S/C16H18N4O/c1-11-8-13(19-21-11)10-20(2)9-12-5-6-15(17)14-4-3-7-18-16(12)14/h3-8H,9-10,17H2,1-2H3 |
| InChIKey | VEUFDDHVSUPRKZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|