About 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine
2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine (PubChem CID 43588484) has the molecular formula C14H30N2O2
and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine.
Molecular Properties
| Compound Name | 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine |
| PubChem CID | 43588484 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine |
| SMILES | COCCN(CCOC)C1CCCCCC1CN |
| InChI | InChI=1S/C14H30N2O2/c1-17-10-8-16(9-11-18-2)14-7-5-3-4-6-13(14)12-15/h13-14H,3-12,15H2,1-2H3 |
| InChIKey | KTFXNUYQACKLBF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine?
The IUPAC name of 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine (CID 43588484) is 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine.
What is the SMILES notation for 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine?
The canonical SMILES for 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine is COCCN(CCOC)C1CCCCCC1CN.
What is the InChIKey of 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine?
The InChIKey is KTFXNUYQACKLBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O2/c1-17-10-8-16(9-11-18-2)14-7-5-3-4-6-13(14)12-15/h13-14H,3-12,15H2,1-2H3.
What are the key properties of 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine?
2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine has a molecular weight of 258.41 g/mol, XLogP of 1.49, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cycloheptan-1-amine is sourced from PubChem (CID 43588484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).