About N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide
N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43588795) has the molecular formula C10H20N2O3S
and a molecular weight of 248.35 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide.
Molecular Properties
| Compound Name | N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide |
| PubChem CID | 43588795 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | COCCN(CCOC)C(=O)C1CSCN1 |
| InChI | InChI=1S/C10H20N2O3S/c1-14-5-3-12(4-6-15-2)10(13)9-7-16-8-11-9/h9,11H,3-8H2,1-2H3 |
| InChIKey | VFAKRRAMQFGXMB-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide?
The IUPAC name of N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide (CID 43588795) is N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide.
What is the SMILES notation for N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide?
The canonical SMILES for N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide is COCCN(CCOC)C(=O)C1CSCN1.
What is the InChIKey of N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide?
The InChIKey is VFAKRRAMQFGXMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3S/c1-14-5-3-12(4-6-15-2)10(13)9-7-16-8-11-9/h9,11H,3-8H2,1-2H3.
What are the key properties of N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide?
N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide has a molecular weight of 248.35 g/mol, XLogP of -0.23, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-methoxyethyl)-1,3-thiazolidine-4-carboxamide is sourced from PubChem (CID 43588795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).