About thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone
thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone (PubChem CID 43588954) has the molecular formula C14H14O4S
and a molecular weight of 278.33 g/mol. Its IUPAC name is thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone.
Molecular Properties
| Compound Name | thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone |
| PubChem CID | 43588954 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccsc2)c(OC)c1OC |
| InChI | InChI=1S/C14H14O4S/c1-16-11-5-4-10(13(17-2)14(11)18-3)12(15)9-6-7-19-8-9/h4-8H,1-3H3 |
| InChIKey | VRTJFHRNGWIPHN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone?
The IUPAC name of thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone (CID 43588954) is thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone.
What is the SMILES notation for thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone?
The canonical SMILES for thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone is COc1ccc(C(=O)c2ccsc2)c(OC)c1OC.
What is the InChIKey of thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone?
The InChIKey is VRTJFHRNGWIPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O4S/c1-16-11-5-4-10(13(17-2)14(11)18-3)12(15)9-6-7-19-8-9/h4-8H,1-3H3.
What are the key properties of thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone?
thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone has a molecular weight of 278.33 g/mol, XLogP of 3.00, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-3-yl-(2,3,4-trimethoxyphenyl)methanone is sourced from PubChem (CID 43588954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).