C16H20N2O3 — CID 43589047
N-methyl-1-pyridin-3-yl-1-(2,3,4-trimethoxyphenyl)methanamine (PubChem CID 43589047) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-methyl-1-pyridin-3-yl-1-(2,3,4-trimethoxyphenyl)methanamine.
| Compound Name | N-methyl-1-pyridin-3-yl-1-(2,3,4-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 43589047 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-methyl-1-pyridin-3-yl-1-(2,3,4-trimethoxyphenyl)methanamine |
| SMILES | CNC(c1cccnc1)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C16H20N2O3/c1-17-14(11-6-5-9-18-10-11)12-7-8-13(19-2)16(21-4)15(12)20-3/h5-10,14,17H,1-4H3 |
| InChIKey | MHMFUEHJWBTKDO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |