C14H19NO3 — CID 43589508
(3-hydroxy-4-methylphenyl)-[3-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 43589508) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (3-hydroxy-4-methylphenyl)-[3-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | (3-hydroxy-4-methylphenyl)-[3-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 43589508 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (3-hydroxy-4-methylphenyl)-[3-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCCC(CO)C2)cc1O |
| InChI | InChI=1S/C14H19NO3/c1-10-4-5-12(7-13(10)17)14(18)15-6-2-3-11(8-15)9-16/h4-5,7,11,16-17H,2-3,6,8-9H2,1H3 |
| InChIKey | KWACDFOZBZNSPN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |