About 1-cyclohexyl-3-decylurea
1-cyclohexyl-3-decylurea (PubChem CID 4359) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-decylurea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-decylurea |
| PubChem CID | 4359 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 1-cyclohexyl-3-decylurea |
| SMILES | CCCCCCCCCCNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H34N2O/c1-2-3-4-5-6-7-8-12-15-18-17(20)19-16-13-10-9-11-14-16/h16H,2-15H2,1H3,(H2,18,19,20) |
| InChIKey | LPXYBLIRYGCMPQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-decylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-decylurea?
The IUPAC name of 1-cyclohexyl-3-decylurea (CID 4359) is 1-cyclohexyl-3-decylurea.
What is the SMILES notation for 1-cyclohexyl-3-decylurea?
The canonical SMILES for 1-cyclohexyl-3-decylurea is CCCCCCCCCCNC(=O)NC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3-decylurea?
The InChIKey is LPXYBLIRYGCMPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O/c1-2-3-4-5-6-7-8-12-15-18-17(20)19-16-13-10-9-11-14-16/h16H,2-15H2,1H3,(H2,18,19,20).
What are the key properties of 1-cyclohexyl-3-decylurea?
1-cyclohexyl-3-decylurea has a molecular weight of 282.47 g/mol, XLogP of 4.76, 10 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-decylurea is sourced from PubChem (CID 4359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).