C9H18N2O2 — CID 43590427
2-amino-1-[3-(hydroxymethyl)piperidin-1-yl]propan-1-one (PubChem CID 43590427) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-amino-1-[3-(hydroxymethyl)piperidin-1-yl]propan-1-one.
| Compound Name | 2-amino-1-[3-(hydroxymethyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 43590427 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-amino-1-[3-(hydroxymethyl)piperidin-1-yl]propan-1-one |
| SMILES | CC(N)C(=O)N1CCCC(CO)C1 |
| InChI | InChI=1S/C9H18N2O2/c1-7(10)9(13)11-4-2-3-8(5-11)6-12/h7-8,12H,2-6,10H2,1H3 |
| InChIKey | JJGLCPFUSPMPRN-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |