About N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide
N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43591422) has the molecular formula C8H16N2O2S
and a molecular weight of 204.29 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide |
| PubChem CID | 43591422 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCOCCNC(=O)C1CSCN1 |
| InChI | InChI=1S/C8H16N2O2S/c1-2-12-4-3-9-8(11)7-5-13-6-10-7/h7,10H,2-6H2,1H3,(H,9,11) |
| InChIKey | ZPJGPVMMAGNBDF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide?
The IUPAC name of N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide (CID 43591422) is N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide.
What is the SMILES notation for N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide?
The canonical SMILES for N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide is CCOCCNC(=O)C1CSCN1.
What is the InChIKey of N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide?
The InChIKey is ZPJGPVMMAGNBDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2S/c1-2-12-4-3-9-8(11)7-5-13-6-10-7/h7,10H,2-6H2,1H3,(H,9,11).
What are the key properties of N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide?
N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide has a molecular weight of 204.29 g/mol, XLogP of -0.20, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxyethyl)-1,3-thiazolidine-4-carboxamide is sourced from PubChem (CID 43591422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).