About [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine
[2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine (PubChem CID 43592477) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine.
Molecular Properties
| Compound Name | [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine |
| PubChem CID | 43592477 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine |
| SMILES | CC1(C)CN(C2CCCC2CN)CCO1 |
| InChI | InChI=1S/C12H24N2O/c1-12(2)9-14(6-7-15-12)11-5-3-4-10(11)8-13/h10-11H,3-9,13H2,1-2H3 |
| InChIKey | OSGGNTRKXOPRSY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine?
The IUPAC name of [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine (CID 43592477) is [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine.
What is the SMILES notation for [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine?
The canonical SMILES for [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine is CC1(C)CN(C2CCCC2CN)CCO1.
What is the InChIKey of [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine?
The InChIKey is OSGGNTRKXOPRSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-12(2)9-14(6-7-15-12)11-5-3-4-10(11)8-13/h10-11H,3-9,13H2,1-2H3.
What are the key properties of [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine?
[2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine has a molecular weight of 212.34 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2-dimethylmorpholin-4-yl)cyclopentyl]methanamine is sourced from PubChem (CID 43592477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).