C13H17F3N2O — CID 43592530
4-(2,2-dimethylmorpholin-4-yl)-2-(trifluoromethyl)aniline (PubChem CID 43592530) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-(2,2-dimethylmorpholin-4-yl)-2-(trifluoromethyl)aniline.
| Compound Name | 4-(2,2-dimethylmorpholin-4-yl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 43592530 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-(2,2-dimethylmorpholin-4-yl)-2-(trifluoromethyl)aniline |
| SMILES | CC1(C)CN(c2ccc(N)c(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C13H17F3N2O/c1-12(2)8-18(5-6-19-12)9-3-4-11(17)10(7-9)13(14,15)16/h3-4,7H,5-6,8,17H2,1-2H3 |
| InChIKey | XURWSGMSFBBALQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|