About 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine
2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine (PubChem CID 43592675) has the molecular formula C14H30N2O
and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine |
| PubChem CID | 43592675 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine |
| SMILES | CC(C)CCC(C)(CN)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C14H30N2O/c1-12(2)6-7-14(5,10-15)16-8-9-17-13(3,4)11-16/h12H,6-11,15H2,1-5H3 |
| InChIKey | WMDKFGDMPOHSHC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine?
The IUPAC name of 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine (CID 43592675) is 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine.
What is the SMILES notation for 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine?
The canonical SMILES for 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine is CC(C)CCC(C)(CN)N1CCOC(C)(C)C1.
What is the InChIKey of 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine?
The InChIKey is WMDKFGDMPOHSHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O/c1-12(2)6-7-14(5,10-15)16-8-9-17-13(3,4)11-16/h12H,6-11,15H2,1-5H3.
What are the key properties of 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine?
2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine has a molecular weight of 242.41 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylmorpholin-4-yl)-2,5-dimethylhexan-1-amine is sourced from PubChem (CID 43592675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).