About 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine
4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine (PubChem CID 43592795) has the molecular formula C10H15ClN2O3S2
and a molecular weight of 310.83 g/mol. Its IUPAC name is 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine |
| PubChem CID | 43592795 |
| Molecular Formula | C10H15ClN2O3S2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C10H15ClN2O3S2/c1-7-8(17-9(11)12-7)18(14,15)13-4-5-16-10(2,3)6-13/h4-6H2,1-3H3 |
| InChIKey | UKFNARDNXUUYNY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine?
The IUPAC name of 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine (CID 43592795) is 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine.
What is the SMILES notation for 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine?
The canonical SMILES for 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine is Cc1nc(Cl)sc1S(=O)(=O)N1CCOC(C)(C)C1.
What is the InChIKey of 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine?
The InChIKey is UKFNARDNXUUYNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2O3S2/c1-7-8(17-9(11)12-7)18(14,15)13-4-5-16-10(2,3)6-13/h4-6H2,1-3H3.
What are the key properties of 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine?
4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine has a molecular weight of 310.83 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,2-dimethylmorpholine is sourced from PubChem (CID 43592795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).