2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid

C10H18N2O4 — CID 43593154

IUPAC2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid
SMILESCN(CC(=O)O)C(=O)N1CCOC(C)(C)C1
InChIInChI=1S/C10H18N2O4/c1-10(2)7-12(4-5-16-10)9(15)11(3)6-8(13)14/h4-7H2,1-3H3,(H,13,14)
InChIKeySHJXROQGLFLJBH-UHFFFAOYSA-N
MW230.26 g/mol
LogP0.23
Rot. Bonds2

About 2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid

2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid (PubChem CID 43593154) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid.

Molecular Properties

Compound Name2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid
PubChem CID43593154
Molecular FormulaC10H18N2O4
Molecular Weight230.26 g/mol
Exact Mass230.13
IUPAC Name2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid
SMILESCN(CC(=O)O)C(=O)N1CCOC(C)(C)C1
InChIInChI=1S/C10H18N2O4/c1-10(2)7-12(4-5-16-10)9(15)11(3)6-8(13)14/h4-7H2,1-3H3,(H,13,14)
InChIKeySHJXROQGLFLJBH-UHFFFAOYSA-N
XLogP0.23
TPSA70.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.26
LogP ≤ 50.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid?
The IUPAC name of 2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid (CID 43593154) is 2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid.
What is the SMILES notation for 2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid?
The canonical SMILES for 2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid is CN(CC(=O)O)C(=O)N1CCOC(C)(C)C1.
What is the InChIKey of 2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid?
The InChIKey is SHJXROQGLFLJBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O4/c1-10(2)7-12(4-5-16-10)9(15)11(3)6-8(13)14/h4-7H2,1-3H3,(H,13,14).
What are the key properties of 2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid?
2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid has a molecular weight of 230.26 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dimethylmorpholine-4-carbonyl)-methylamino]acetic acid is sourced from PubChem (CID 43593154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).