C9H12N4OS — CID 43594578
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1,2,5-thiadiazol-3-yl)methanone (PubChem CID 43594578) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1,2,5-thiadiazol-3-yl)methanone.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1,2,5-thiadiazol-3-yl)methanone |
|---|---|
| PubChem CID | 43594578 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1,2,5-thiadiazol-3-yl)methanone |
| SMILES | O=C(c1cnsn1)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C9H12N4OS/c14-9(7-4-11-15-12-7)13-2-1-6-3-10-5-8(6)13/h4,6,8,10H,1-3,5H2/t6-,8+/m0/s1 |
| InChIKey | MVUJSJUSLMCAGN-POYBYMJQSA-N |
| XLogP | -0.03 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |