C15H18F2N2O — CID 43595348
N-(5-azaspiro[3.5]nonan-8-yl)-2,6-difluorobenzamide (PubChem CID 43595348) has the molecular formula C15H18F2N2O and a molecular weight of 280.32 g/mol. Its IUPAC name is N-(5-azaspiro[3.5]nonan-8-yl)-2,6-difluorobenzamide.
| Compound Name | N-(5-azaspiro[3.5]nonan-8-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 43595348 |
| Molecular Formula | C15H18F2N2O |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-(5-azaspiro[3.5]nonan-8-yl)-2,6-difluorobenzamide |
| SMILES | O=C(NC1CCNC2(CCC2)C1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H18F2N2O/c16-11-3-1-4-12(17)13(11)14(20)19-10-5-8-18-15(9-10)6-2-7-15/h1,3-4,10,18H,2,5-9H2,(H,19,20) |
| InChIKey | LSHUTWUKGZCGQX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |