C12H16N4O3 — CID 43595358
5-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)-1H-pyrimidine-2,4-dione (PubChem CID 43595358) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 5-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 43595358 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 5-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC1CC2CNCC2N1C(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H16N4O3/c1-6-2-7-3-13-5-9(7)16(6)11(18)8-4-14-12(19)15-10(8)17/h4,6-7,9,13H,2-3,5H2,1H3,(H2,14,15,17,19) |
| InChIKey | RJWWSEANYICYGZ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |