C10H14N4OS — CID 43595400
(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-(1,2,5-thiadiazol-3-yl)methanone (PubChem CID 43595400) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is (2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-(1,2,5-thiadiazol-3-yl)methanone.
| Compound Name | (2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-(1,2,5-thiadiazol-3-yl)methanone |
|---|---|
| PubChem CID | 43595400 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-(1,2,5-thiadiazol-3-yl)methanone |
| SMILES | CC1CC2CNCC2N1C(=O)c1cnsn1 |
| InChI | InChI=1S/C10H14N4OS/c1-6-2-7-3-11-5-9(7)14(6)10(15)8-4-12-16-13-8/h4,6-7,9,11H,2-3,5H2,1H3 |
| InChIKey | AYFYQGKRAKKOLV-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |