C12H20N2O3S — CID 43595593
(1,1-dioxothiolan-3-yl)-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)methanone (PubChem CID 43595593) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)methanone.
| Compound Name | (1,1-dioxothiolan-3-yl)-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 43595593 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)methanone |
| SMILES | CC1CC2CNCC2N1C(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20N2O3S/c1-8-4-10-5-13-6-11(10)14(8)12(15)9-2-3-18(16,17)7-9/h8-11,13H,2-7H2,1H3 |
| InChIKey | XEVFKWWIESKZDU-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |