About N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide
N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide (PubChem CID 43595898) has the molecular formula C8H14N6O2
and a molecular weight of 226.24 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide |
| PubChem CID | 43595898 |
| Molecular Formula | C8H14N6O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide |
| SMILES | CN(C(=O)Cn1cnnn1)[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C8H14N6O2/c1-13(6-2-9-3-7(6)15)8(16)4-14-5-10-11-12-14/h5-7,9,15H,2-4H2,1H3/t6-,7-/m1/s1 |
| InChIKey | BBNSEUNFEPYMMH-RNFRBKRXSA-N |
| XLogP | -2.54 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide?
The IUPAC name of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide (CID 43595898) is N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide.
What is the SMILES notation for N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide?
The canonical SMILES for N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide is CN(C(=O)Cn1cnnn1)[C@@H]1CNC[C@H]1O.
What is the InChIKey of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide?
The InChIKey is BBNSEUNFEPYMMH-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H14N6O2/c1-13(6-2-9-3-7(6)15)8(16)4-14-5-10-11-12-14/h5-7,9,15H,2-4H2,1H3/t6-,7-/m1/s1.
What are the key properties of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide?
N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide has a molecular weight of 226.24 g/mol, XLogP of -2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-2-(tetrazol-1-yl)acetamide is sourced from PubChem (CID 43595898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).