C11H16N4OS — CID 43596092
[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,2,5-thiadiazol-3-yl)methanone (PubChem CID 43596092) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,2,5-thiadiazol-3-yl)methanone.
| Compound Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,2,5-thiadiazol-3-yl)methanone |
|---|---|
| PubChem CID | 43596092 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,2,5-thiadiazol-3-yl)methanone |
| SMILES | NC1CC[C@@H]2CN(C(=O)c3cnsn3)C[C@@H]2C1 |
| InChI | InChI=1S/C11H16N4OS/c12-9-2-1-7-5-15(6-8(7)3-9)11(16)10-4-13-17-14-10/h4,7-9H,1-3,5-6,12H2/t7-,8+,9?/m1/s1 |
| InChIKey | HMOIBTYPWXEGTA-WGTSGOJVSA-N |
| XLogP | 0.74 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |