C13H22N2O2 — CID 43596127
[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(oxolan-2-yl)methanone (PubChem CID 43596127) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(oxolan-2-yl)methanone.
| Compound Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 43596127 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(oxolan-2-yl)methanone |
| SMILES | NC1CC[C@@H]2CN(C(=O)C3CCCO3)C[C@@H]2C1 |
| InChI | InChI=1S/C13H22N2O2/c14-11-4-3-9-7-15(8-10(9)6-11)13(16)12-2-1-5-17-12/h9-12H,1-8,14H2/t9-,10+,11?,12?/m1/s1 |
| InChIKey | UMNBVHRXGNPADK-QKEWWQLBSA-N |
| XLogP | 0.75 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |