C14H18N4O — CID 43596560
N-[3-(cyclopropylamino)propyl]-1H-indazole-3-carboxamide (PubChem CID 43596560) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is N-[3-(cyclopropylamino)propyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[3-(cyclopropylamino)propyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 43596560 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-[3-(cyclopropylamino)propyl]-1H-indazole-3-carboxamide |
| SMILES | O=C(NCCCNC1CC1)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C14H18N4O/c19-14(16-9-3-8-15-10-6-7-10)13-11-4-1-2-5-12(11)17-18-13/h1-2,4-5,10,15H,3,6-9H2,(H,16,19)(H,17,18) |
| InChIKey | SNWVHJCXUBPCJS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|