About 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea
3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea (PubChem CID 43596816) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea.
Molecular Properties
| Compound Name | 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea |
| PubChem CID | 43596816 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea |
| SMILES | CN(C(=O)NC1CCCCC1)[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C12H23N3O2/c1-15(10-7-13-8-11(10)16)12(17)14-9-5-3-2-4-6-9/h9-11,13,16H,2-8H2,1H3,(H,14,17)/t10-,11-/m1/s1 |
| InChIKey | ZISYWNWTTZRLMK-GHMZBOCLSA-N |
| XLogP | 0.29 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea?
The IUPAC name of 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea (CID 43596816) is 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea.
What is the SMILES notation for 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea?
The canonical SMILES for 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea is CN(C(=O)NC1CCCCC1)[C@@H]1CNC[C@H]1O.
What is the InChIKey of 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea?
The InChIKey is ZISYWNWTTZRLMK-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H23N3O2/c1-15(10-7-13-8-11(10)16)12(17)14-9-5-3-2-4-6-9/h9-11,13,16H,2-8H2,1H3,(H,14,17)/t10-,11-/m1/s1.
What are the key properties of 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea?
3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea has a molecular weight of 241.33 g/mol, XLogP of 0.29, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methylurea is sourced from PubChem (CID 43596816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).