About N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide
N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide (PubChem CID 43597024) has the molecular formula C10H21N3O2S
and a molecular weight of 247.36 g/mol. Its IUPAC name is N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide |
| PubChem CID | 43597024 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)NC2CC2N)C1 |
| InChI | InChI=1S/C10H21N3O2S/c1-7-3-8(2)6-13(5-7)16(14,15)12-10-4-9(10)11/h7-10,12H,3-6,11H2,1-2H3 |
| InChIKey | IJKFAXZAIOPUPR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide?
The IUPAC name of N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide (CID 43597024) is N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide.
What is the SMILES notation for N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide?
The canonical SMILES for N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide is CC1CC(C)CN(S(=O)(=O)NC2CC2N)C1.
What is the InChIKey of N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide?
The InChIKey is IJKFAXZAIOPUPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O2S/c1-7-3-8(2)6-13(5-7)16(14,15)12-10-4-9(10)11/h7-10,12H,3-6,11H2,1-2H3.
What are the key properties of N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide?
N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide has a molecular weight of 247.36 g/mol, XLogP of -0.10, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminocyclopropyl)-3,5-dimethylpiperidine-1-sulfonamide is sourced from PubChem (CID 43597024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).