C11H23N3O2S — CID 43597344
6-(dipropylsulfamoylamino)-3-azabicyclo[3.1.0]hexane (PubChem CID 43597344) has the molecular formula C11H23N3O2S and a molecular weight of 261.39 g/mol. Its IUPAC name is 6-(dipropylsulfamoylamino)-3-azabicyclo[3.1.0]hexane.
| Compound Name | 6-(dipropylsulfamoylamino)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 43597344 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 6-(dipropylsulfamoylamino)-3-azabicyclo[3.1.0]hexane |
| SMILES | CCCN(CCC)S(=O)(=O)NC1C2CNCC21 |
| InChI | InChI=1S/C11H23N3O2S/c1-3-5-14(6-4-2)17(15,16)13-11-9-7-12-8-10(9)11/h9-13H,3-8H2,1-2H3 |
| InChIKey | ZFRGUTXGYFRZAR-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |