C10H18N2O4S2 — CID 43597546
3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl]sulfonyl]thiolane 1,1-dioxide (PubChem CID 43597546) has the molecular formula C10H18N2O4S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl]sulfonyl]thiolane 1,1-dioxide.
| Compound Name | 3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl]sulfonyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 43597546 |
| Molecular Formula | C10H18N2O4S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl]sulfonyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N2CC[C@H]3CNC[C@H]32)C1 |
| InChI | InChI=1S/C10H18N2O4S2/c13-17(14)4-2-9(7-17)18(15,16)12-3-1-8-5-11-6-10(8)12/h8-11H,1-7H2/t8-,9?,10+/m0/s1 |
| InChIKey | CKJHEGRDVNOTMJ-DJBFQZMMSA-N |
| XLogP | -1.20 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |