C10H12Cl2N2O2S2 — CID 43597637
(3aS,6aS)-1-(2,5-dichlorothiophen-3-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 43597637) has the molecular formula C10H12Cl2N2O2S2 and a molecular weight of 327.26 g/mol. Its IUPAC name is (3aS,6aS)-1-(2,5-dichlorothiophen-3-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-1-(2,5-dichlorothiophen-3-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 43597637 |
| Molecular Formula | C10H12Cl2N2O2S2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | (3aS,6aS)-1-(2,5-dichlorothiophen-3-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | O=S(=O)(c1cc(Cl)sc1Cl)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C10H12Cl2N2O2S2/c11-9-3-8(10(12)17-9)18(15,16)14-2-1-6-4-13-5-7(6)14/h3,6-7,13H,1-2,4-5H2/t6-,7+/m0/s1 |
| InChIKey | RVIQHMFEEAPOPL-NKWVEPMBSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |