C10H13ClN2O2S2 — CID 43597641
(3aS,6aS)-1-(5-chlorothiophen-2-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 43597641) has the molecular formula C10H13ClN2O2S2 and a molecular weight of 292.81 g/mol. Its IUPAC name is (3aS,6aS)-1-(5-chlorothiophen-2-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-1-(5-chlorothiophen-2-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 43597641 |
| Molecular Formula | C10H13ClN2O2S2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | (3aS,6aS)-1-(5-chlorothiophen-2-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | O=S(=O)(c1ccc(Cl)s1)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C10H13ClN2O2S2/c11-9-1-2-10(16-9)17(14,15)13-4-3-7-5-12-6-8(7)13/h1-2,7-8,12H,3-6H2/t7-,8+/m0/s1 |
| InChIKey | ZNUFBDUGBMGBKY-JGVFFNPUSA-N |
| XLogP | 1.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |