C11H20N2O4S2 — CID 43598019
3-[(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl)sulfonyl]thiolane 1,1-dioxide (PubChem CID 43598019) has the molecular formula C11H20N2O4S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 3-[(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl)sulfonyl]thiolane 1,1-dioxide.
| Compound Name | 3-[(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl)sulfonyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 43598019 |
| Molecular Formula | C11H20N2O4S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3-[(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrol-1-yl)sulfonyl]thiolane 1,1-dioxide |
| SMILES | CC1CC2CNCC2N1S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O4S2/c1-8-4-9-5-12-6-11(9)13(8)19(16,17)10-2-3-18(14,15)7-10/h8-12H,2-7H2,1H3 |
| InChIKey | UOCMYTBRTDAWFE-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |