About 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide
3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide (PubChem CID 43598448) has the molecular formula C11H14ClFN2O3S
and a molecular weight of 308.76 g/mol. Its IUPAC name is 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide |
| PubChem CID | 43598448 |
| Molecular Formula | C11H14ClFN2O3S |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide |
| SMILES | CN([C@@H]1CNC[C@H]1O)S(=O)(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C11H14ClFN2O3S/c1-15(8-5-14-6-9(8)16)19(17,18)10-4-2-3-7(12)11(10)13/h2-4,8-9,14,16H,5-6H2,1H3/t8-,9-/m1/s1 |
| InChIKey | AWRHQCVUGHQKIP-RKDXNWHRSA-N |
| XLogP | 0.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide?
The IUPAC name of 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide (CID 43598448) is 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide.
What is the SMILES notation for 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide?
The canonical SMILES for 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide is CN([C@@H]1CNC[C@H]1O)S(=O)(=O)c1cccc(Cl)c1F.
What is the InChIKey of 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide?
The InChIKey is AWRHQCVUGHQKIP-RKDXNWHRSA-N. The full InChI is InChI=1S/C11H14ClFN2O3S/c1-15(8-5-14-6-9(8)16)19(17,18)10-4-2-3-7(12)11(10)13/h2-4,8-9,14,16H,5-6H2,1H3/t8-,9-/m1/s1.
What are the key properties of 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide?
3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide has a molecular weight of 308.76 g/mol, XLogP of 0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-fluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylbenzenesulfonamide is sourced from PubChem (CID 43598448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).