About 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide
1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide (PubChem CID 43598471) has the molecular formula C6H12F2N2O3S
and a molecular weight of 230.24 g/mol. Its IUPAC name is 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide |
| PubChem CID | 43598471 |
| Molecular Formula | C6H12F2N2O3S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide |
| SMILES | CN([C@@H]1CNC[C@H]1O)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C6H12F2N2O3S/c1-10(14(12,13)6(7)8)4-2-9-3-5(4)11/h4-6,9,11H,2-3H2,1H3/t4-,5-/m1/s1 |
| InChIKey | ZNCMTKZSCCYDCR-RFZPGFLSSA-N |
| XLogP | -1.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide?
The IUPAC name of 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide (CID 43598471) is 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide.
What is the SMILES notation for 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide?
The canonical SMILES for 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide is CN([C@@H]1CNC[C@H]1O)S(=O)(=O)C(F)F.
What is the InChIKey of 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide?
The InChIKey is ZNCMTKZSCCYDCR-RFZPGFLSSA-N. The full InChI is InChI=1S/C6H12F2N2O3S/c1-10(14(12,13)6(7)8)4-2-9-3-5(4)11/h4-6,9,11H,2-3H2,1H3/t4-,5-/m1/s1.
What are the key properties of 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide?
1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide has a molecular weight of 230.24 g/mol, XLogP of -1.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methylmethanesulfonamide is sourced from PubChem (CID 43598471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).