C14H27N3O2S — CID 43598555
(3aR,7aS)-2-(azepan-1-ylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 43598555) has the molecular formula C14H27N3O2S and a molecular weight of 301.46 g/mol. Its IUPAC name is (3aR,7aS)-2-(azepan-1-ylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aR,7aS)-2-(azepan-1-ylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 43598555 |
| Molecular Formula | C14H27N3O2S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (3aR,7aS)-2-(azepan-1-ylsulfonyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | NC1CC[C@@H]2CN(S(=O)(=O)N3CCCCCC3)C[C@@H]2C1 |
| InChI | InChI=1S/C14H27N3O2S/c15-14-6-5-12-10-17(11-13(12)9-14)20(18,19)16-7-3-1-2-4-8-16/h12-14H,1-11,15H2/t12-,13+,14?/m1/s1 |
| InChIKey | NEHKXQJXTBNVOD-AMIUJLCOSA-N |
| XLogP | 1.17 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |