C15H19N3S — CID 43599441
N-(5-azaspiro[3.5]nonan-8-yl)thieno[3,2-c]pyridin-4-amine (PubChem CID 43599441) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is N-(5-azaspiro[3.5]nonan-8-yl)thieno[3,2-c]pyridin-4-amine.
| Compound Name | N-(5-azaspiro[3.5]nonan-8-yl)thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 43599441 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-(5-azaspiro[3.5]nonan-8-yl)thieno[3,2-c]pyridin-4-amine |
| SMILES | c1cc2sccc2c(NC2CCNC3(CCC3)C2)n1 |
| InChI | InChI=1S/C15H19N3S/c1-5-15(6-1)10-11(2-8-17-15)18-14-12-4-9-19-13(12)3-7-16-14/h3-4,7,9,11,17H,1-2,5-6,8,10H2,(H,16,18) |
| InChIKey | VNCRYHLAOVBIPN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |