About N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide
N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide (PubChem CID 43602820) has the molecular formula C8H15F3N2O2S
and a molecular weight of 260.28 g/mol. Its IUPAC name is N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide |
| PubChem CID | 43602820 |
| Molecular Formula | C8H15F3N2O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CC(F)(F)F)C1CCNCC1 |
| InChI | InChI=1S/C8H15F3N2O2S/c1-16(14,15)13(6-8(9,10)11)7-2-4-12-5-3-7/h7,12H,2-6H2,1H3 |
| InChIKey | BMDKNRLJRHTFMR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide?
The IUPAC name of N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide (CID 43602820) is N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide.
What is the SMILES notation for N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide?
The canonical SMILES for N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide is CS(=O)(=O)N(CC(F)(F)F)C1CCNCC1.
What is the InChIKey of N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide?
The InChIKey is BMDKNRLJRHTFMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O2S/c1-16(14,15)13(6-8(9,10)11)7-2-4-12-5-3-7/h7,12H,2-6H2,1H3.
What are the key properties of N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide?
N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide has a molecular weight of 260.28 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide is sourced from PubChem (CID 43602820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).