C12H23N3O2S — CID 43602957
(3aS,6aS)-5-(azepan-1-ylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole (PubChem CID 43602957) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is (3aS,6aS)-5-(azepan-1-ylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-5-(azepan-1-ylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 43602957 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (3aS,6aS)-5-(azepan-1-ylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
| SMILES | O=S(=O)(N1CCCCCC1)N1C[C@@H]2CCN[C@@H]2C1 |
| InChI | InChI=1S/C12H23N3O2S/c16-18(17,14-7-3-1-2-4-8-14)15-9-11-5-6-13-12(11)10-15/h11-13H,1-10H2/t11-,12+/m0/s1 |
| InChIKey | SXBSZPKDMPMOLH-NWDGAFQWSA-N |
| XLogP | 0.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |