About N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide
N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 43603601) has the molecular formula C9H15N5O
and a molecular weight of 209.25 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide |
| PubChem CID | 43603601 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | O=C(CCn1cncn1)NC1CCNC1 |
| InChI | InChI=1S/C9H15N5O/c15-9(13-8-1-3-10-5-8)2-4-14-7-11-6-12-14/h6-8,10H,1-5H2,(H,13,15) |
| InChIKey | XORNIZMOBDMSLD-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide?
The IUPAC name of N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide (CID 43603601) is N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide.
What is the SMILES notation for N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide?
The canonical SMILES for N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide is O=C(CCn1cncn1)NC1CCNC1.
What is the InChIKey of N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide?
The InChIKey is XORNIZMOBDMSLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O/c15-9(13-8-1-3-10-5-8)2-4-14-7-11-6-12-14/h6-8,10H,1-5H2,(H,13,15).
What are the key properties of N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide?
N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide has a molecular weight of 209.25 g/mol, XLogP of -0.85, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrrolidin-3-yl-3-(1,2,4-triazol-1-yl)propanamide is sourced from PubChem (CID 43603601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).