C8H10F2N2O2S — CID 43604018
1,1-difluoro-N-[4-(methylamino)phenyl]methanesulfonamide (PubChem CID 43604018) has the molecular formula C8H10F2N2O2S and a molecular weight of 236.24 g/mol. Its IUPAC name is 1,1-difluoro-N-[4-(methylamino)phenyl]methanesulfonamide.
| Compound Name | 1,1-difluoro-N-[4-(methylamino)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 43604018 |
| Molecular Formula | C8H10F2N2O2S |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 1,1-difluoro-N-[4-(methylamino)phenyl]methanesulfonamide |
| SMILES | CNc1ccc(NS(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C8H10F2N2O2S/c1-11-6-2-4-7(5-3-6)12-15(13,14)8(9)10/h2-5,8,11-12H,1H3 |
| InChIKey | WDYALMHSDVGDMA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |