C13H12F2N2O2S — CID 43604849
N-(4-amino-3-methylphenyl)-3,5-difluorobenzenesulfonamide (PubChem CID 43604849) has the molecular formula C13H12F2N2O2S and a molecular weight of 298.31 g/mol. Its IUPAC name is N-(4-amino-3-methylphenyl)-3,5-difluorobenzenesulfonamide.
| Compound Name | N-(4-amino-3-methylphenyl)-3,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 43604849 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-(4-amino-3-methylphenyl)-3,5-difluorobenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(F)cc(F)c2)ccc1N |
| InChI | InChI=1S/C13H12F2N2O2S/c1-8-4-11(2-3-13(8)16)17-20(18,19)12-6-9(14)5-10(15)7-12/h2-7,17H,16H2,1H3 |
| InChIKey | AZORUNYHCSSRDV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|